C14H26N2O4 — CID 160705460
N-(2-methoxyethyl)-2-methylprop-2-enamide;5-methoxy-2-methylpent-2-enamide (PubChem CID 160705460) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-methylprop-2-enamide;5-methoxy-2-methylpent-2-enamide.
| Compound Name | N-(2-methoxyethyl)-2-methylprop-2-enamide;5-methoxy-2-methylpent-2-enamide |
|---|---|
| PubChem CID | 160705460 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | N-(2-methoxyethyl)-2-methylprop-2-enamide;5-methoxy-2-methylpent-2-enamide |
| SMILES | C=C(C)C(=O)NCCOC.COCCC=C(C)C(N)=O |
| InChI | InChI=1S/2C7H13NO2/c1-6(2)7(9)8-4-5-10-3;1-6(7(8)9)4-3-5-10-2/h1,4-5H2,2-3H3,(H,8,9);4H,3,5H2,1-2H3,(H2,8,9) |
| InChIKey | RRDXOOHDGYODBL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|