C21H31N3O7 — CID 145466867
2-[[2-methyl-4-[methyl(propanoyl)amino]butan-2-yl]-propanoylamino]ethyl (4-nitrophenyl) carbonate (PubChem CID 145466867) has the molecular formula C21H31N3O7 and a molecular weight of 437.49 g/mol. Its IUPAC name is 2-[[2-methyl-4-[methyl(propanoyl)amino]butan-2-yl]-propanoylamino]ethyl (4-nitrophenyl) carbonate.
| Compound Name | 2-[[2-methyl-4-[methyl(propanoyl)amino]butan-2-yl]-propanoylamino]ethyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 145466867 |
| Molecular Formula | C21H31N3O7 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 2-[[2-methyl-4-[methyl(propanoyl)amino]butan-2-yl]-propanoylamino]ethyl (4-nitrophenyl) carbonate |
| SMILES | CCC(=O)N(C)CCC(C)(C)N(CCOC(=O)Oc1ccc([N+](=O)[O-])cc1)C(=O)CC |
| InChI | InChI=1S/C21H31N3O7/c1-6-18(25)22(5)13-12-21(3,4)23(19(26)7-2)14-15-30-20(27)31-17-10-8-16(9-11-17)24(28)29/h8-11H,6-7,12-15H2,1-5H3 |
| InChIKey | JWVWIWAVLFASQB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|