About (E,3E)-4-(4-bromo-2-fluorophenoxy)-N-methoxyhexa-3,5-dien-2-imine
(E,3E)-4-(4-bromo-2-fluorophenoxy)-N-methoxyhexa-3,5-dien-2-imine (PubChem CID 145469877) has the molecular formula C13H13BrFNO2
and a molecular weight of 314.15 g/mol. Its IUPAC name is (E,3E)-4-(4-bromo-2-fluorophenoxy)-N-methoxyhexa-3,5-dien-2-imine.
Molecular Properties
| Compound Name | (E,3E)-4-(4-bromo-2-fluorophenoxy)-N-methoxyhexa-3,5-dien-2-imine |
| PubChem CID | 145469877 |
| Molecular Formula | C13H13BrFNO2 |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | (E,3E)-4-(4-bromo-2-fluorophenoxy)-N-methoxyhexa-3,5-dien-2-imine |
| SMILES | C=C/C(=C\C(C)=N\OC)Oc1ccc(Br)cc1F |
| InChI | InChI=1S/C13H13BrFNO2/c1-4-11(7-9(2)16-17-3)18-13-6-5-10(14)8-12(13)15/h4-8H,1H2,2-3H3/b11-7+,16-9+ |
| InChIKey | SGFTYCPHLKWPPB-RVTOWZEQSA-N |
| XLogP | 4.06 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E,3E)-4-(4-bromo-2-fluorophenoxy)-N-methoxyhexa-3,5-dien-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,3E)-4-(4-bromo-2-fluorophenoxy)-N-methoxyhexa-3,5-dien-2-imine?
The IUPAC name of (E,3E)-4-(4-bromo-2-fluorophenoxy)-N-methoxyhexa-3,5-dien-2-imine (CID 145469877) is (E,3E)-4-(4-bromo-2-fluorophenoxy)-N-methoxyhexa-3,5-dien-2-imine.
What is the SMILES notation for (E,3E)-4-(4-bromo-2-fluorophenoxy)-N-methoxyhexa-3,5-dien-2-imine?
The canonical SMILES for (E,3E)-4-(4-bromo-2-fluorophenoxy)-N-methoxyhexa-3,5-dien-2-imine is C=C/C(=C\C(C)=N\OC)Oc1ccc(Br)cc1F.
What is the InChIKey of (E,3E)-4-(4-bromo-2-fluorophenoxy)-N-methoxyhexa-3,5-dien-2-imine?
The InChIKey is SGFTYCPHLKWPPB-RVTOWZEQSA-N. The full InChI is InChI=1S/C13H13BrFNO2/c1-4-11(7-9(2)16-17-3)18-13-6-5-10(14)8-12(13)15/h4-8H,1H2,2-3H3/b11-7+,16-9+.
What are the key properties of (E,3E)-4-(4-bromo-2-fluorophenoxy)-N-methoxyhexa-3,5-dien-2-imine?
(E,3E)-4-(4-bromo-2-fluorophenoxy)-N-methoxyhexa-3,5-dien-2-imine has a molecular weight of 314.15 g/mol, XLogP of 4.06, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,3E)-4-(4-bromo-2-fluorophenoxy)-N-methoxyhexa-3,5-dien-2-imine is sourced from PubChem (CID 145469877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).