C17H22BN3O2 — CID 145471006
2-imidazol-1-yl-1-[5-(4,4,5,5-tetramethyloxaborolan-2-yl)-2-pyridinyl]ethanone (PubChem CID 145471006) has the molecular formula C17H22BN3O2 and a molecular weight of 311.19 g/mol. Its IUPAC name is 2-imidazol-1-yl-1-[5-(4,4,5,5-tetramethyloxaborolan-2-yl)-2-pyridinyl]ethanone.
| Compound Name | 2-imidazol-1-yl-1-[5-(4,4,5,5-tetramethyloxaborolan-2-yl)-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 145471006 |
| Molecular Formula | C17H22BN3O2 |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 2-imidazol-1-yl-1-[5-(4,4,5,5-tetramethyloxaborolan-2-yl)-2-pyridinyl]ethanone |
| SMILES | CC1(C)CB(c2ccc(C(=O)Cn3ccnc3)nc2)OC1(C)C |
| InChI | InChI=1S/C17H22BN3O2/c1-16(2)11-18(23-17(16,3)4)13-5-6-14(20-9-13)15(22)10-21-8-7-19-12-21/h5-9,12H,10-11H2,1-4H3 |
| InChIKey | XXWFNLYQAYSBCP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|