About N-methyl-3-pyrrolidin-1-ylpropan-1-imine;phenylmethanol;vanadium
N-methyl-3-pyrrolidin-1-ylpropan-1-imine;phenylmethanol;vanadium (PubChem CID 145472861) has the molecular formula C15H24N2OV
and a molecular weight of 299.31 g/mol. Its IUPAC name is N-methyl-3-pyrrolidin-1-ylpropan-1-imine;phenylmethanol;vanadium.
Molecular Properties
| Compound Name | N-methyl-3-pyrrolidin-1-ylpropan-1-imine;phenylmethanol;vanadium |
| PubChem CID | 145472861 |
| Molecular Formula | C15H24N2OV |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-methyl-3-pyrrolidin-1-ylpropan-1-imine;phenylmethanol;vanadium |
| SMILES | C/N=C/CCN1CCCC1.OCc1ccccc1.[V] |
| InChI | InChI=1S/C8H16N2.C7H8O.V/c1-9-5-4-8-10-6-2-3-7-10;8-6-7-4-2-1-3-5-7;/h5H,2-4,6-8H2,1H3;1-5,8H,6H2;/b9-5+;; |
| InChIKey | KRIYWQKMIUQAMG-KJDUPKRESA-N |
| XLogP | 2.35 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3-pyrrolidin-1-ylpropan-1-imine;phenylmethanol;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-pyrrolidin-1-ylpropan-1-imine;phenylmethanol;vanadium?
The IUPAC name of N-methyl-3-pyrrolidin-1-ylpropan-1-imine;phenylmethanol;vanadium (CID 145472861) is N-methyl-3-pyrrolidin-1-ylpropan-1-imine;phenylmethanol;vanadium.
What is the SMILES notation for N-methyl-3-pyrrolidin-1-ylpropan-1-imine;phenylmethanol;vanadium?
The canonical SMILES for N-methyl-3-pyrrolidin-1-ylpropan-1-imine;phenylmethanol;vanadium is C/N=C/CCN1CCCC1.OCc1ccccc1.[V].
What is the InChIKey of N-methyl-3-pyrrolidin-1-ylpropan-1-imine;phenylmethanol;vanadium?
The InChIKey is KRIYWQKMIUQAMG-KJDUPKRESA-N. The full InChI is InChI=1S/C8H16N2.C7H8O.V/c1-9-5-4-8-10-6-2-3-7-10;8-6-7-4-2-1-3-5-7;/h5H,2-4,6-8H2,1H3;1-5,8H,6H2;/b9-5+;;.
What are the key properties of N-methyl-3-pyrrolidin-1-ylpropan-1-imine;phenylmethanol;vanadium?
N-methyl-3-pyrrolidin-1-ylpropan-1-imine;phenylmethanol;vanadium has a molecular weight of 299.31 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-pyrrolidin-1-ylpropan-1-imine;phenylmethanol;vanadium is sourced from PubChem (CID 145472861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).