C13H18N2O — CID 59788102
(E)-1-(1-methylpyrrolidin-2-yl)-N-phenylmethoxymethanimine (PubChem CID 59788102) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is (E)-1-(1-methylpyrrolidin-2-yl)-N-phenylmethoxymethanimine.
| Compound Name | (E)-1-(1-methylpyrrolidin-2-yl)-N-phenylmethoxymethanimine |
|---|---|
| PubChem CID | 59788102 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | (E)-1-(1-methylpyrrolidin-2-yl)-N-phenylmethoxymethanimine |
| SMILES | CN1CCCC1/C=N/OCc1ccccc1 |
| InChI | InChI=1S/C13H18N2O/c1-15-9-5-8-13(15)10-14-16-11-12-6-3-2-4-7-12/h2-4,6-7,10,13H,5,8-9,11H2,1H3/b14-10+ |
| InChIKey | OZSIGQXBCXELAR-GXDHUFHOSA-N |
| XLogP | 2.28 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|