C23H34N2O — CID 10948221
(5E)-5-phenylmethoxyimino-N,N-dipropyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine (PubChem CID 10948221) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is (5E)-5-phenylmethoxyimino-N,N-dipropyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine.
| Compound Name | (5E)-5-phenylmethoxyimino-N,N-dipropyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine |
|---|---|
| PubChem CID | 10948221 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | (5E)-5-phenylmethoxyimino-N,N-dipropyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine |
| SMILES | CCCN(CCC)C1CCC2=C(CCC/C2=N\OCc2ccccc2)C1 |
| InChI | InChI=1S/C23H34N2O/c1-3-15-25(16-4-2)21-13-14-22-20(17-21)11-8-12-23(22)24-26-18-19-9-6-5-7-10-19/h5-7,9-10,21H,3-4,8,11-18H2,1-2H3/b24-23+ |
| InChIKey | FFMNBPGWAAZQPB-WCWDXBQESA-N |
| XLogP | 5.71 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|