C20H36N2O — CID 85398429
5-butoxyimino-N,N-dipropyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine (PubChem CID 85398429) has the molecular formula C20H36N2O and a molecular weight of 320.52 g/mol. Its IUPAC name is 5-butoxyimino-N,N-dipropyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine.
| Compound Name | 5-butoxyimino-N,N-dipropyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine |
|---|---|
| PubChem CID | 85398429 |
| Molecular Formula | C20H36N2O |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.28 |
| IUPAC Name | 5-butoxyimino-N,N-dipropyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine |
| SMILES | CCCCON=C1CCCC2=C1CCC(N(CCC)CCC)C2 |
| InChI | InChI=1S/C20H36N2O/c1-4-7-15-23-21-20-10-8-9-17-16-18(11-12-19(17)20)22(13-5-2)14-6-3/h18H,4-16H2,1-3H3 |
| InChIKey | RUTZPSMGMJGJHC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|