C23H32N2O2 — CID 10872302
[(E)-[6-(dipropylamino)-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-ylidene]amino] benzoate (PubChem CID 10872302) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is [(E)-[6-(dipropylamino)-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-ylidene]amino] benzoate.
| Compound Name | [(E)-[6-(dipropylamino)-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 10872302 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | [(E)-[6-(dipropylamino)-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-ylidene]amino] benzoate |
| SMILES | CCCN(CCC)C1CCC2=C(CCC/C2=N\OC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C23H32N2O2/c1-3-15-25(16-4-2)20-13-14-21-19(17-20)11-8-12-22(21)24-27-23(26)18-9-6-5-7-10-18/h5-7,9-10,20H,3-4,8,11-17H2,1-2H3/b24-22+ |
| InChIKey | DFHJGWUDXWMIOD-ZNTNEXAZSA-N |
| XLogP | 5.35 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|