C16H29N3 — CID 149158732
5-hydrazinylidene-N,N-dipropyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine (PubChem CID 149158732) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is 5-hydrazinylidene-N,N-dipropyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine.
| Compound Name | 5-hydrazinylidene-N,N-dipropyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine |
|---|---|
| PubChem CID | 149158732 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | 5-hydrazinylidene-N,N-dipropyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine |
| SMILES | CCCN(CCC)C1CCC2=C(CCCC2=NN)C1 |
| InChI | InChI=1S/C16H29N3/c1-3-10-19(11-4-2)14-8-9-15-13(12-14)6-5-7-16(15)18-17/h14H,3-12,17H2,1-2H3 |
| InChIKey | VJPQVKHUQYLUAQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|