C21H33NO5 — CID 70114751
(Z)-but-2-enedioic acid;6-[butyl(propyl)amino]-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one (PubChem CID 70114751) has the molecular formula C21H33NO5 and a molecular weight of 379.50 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;6-[butyl(propyl)amino]-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one.
| Compound Name | (Z)-but-2-enedioic acid;6-[butyl(propyl)amino]-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 70114751 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | (Z)-but-2-enedioic acid;6-[butyl(propyl)amino]-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one |
| SMILES | CCCCN(CCC)C1CCC2=C(CCCC2=O)C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H29NO.C4H4O4/c1-3-5-12-18(11-4-2)15-9-10-16-14(13-15)7-6-8-17(16)19;5-3(6)1-2-4(7)8/h15H,3-13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | YOXVSKKPHSXIGW-BTJKTKAUSA-N |
| XLogP | 3.81 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|