C19H27F3N2O — CID 162414091
(E)-2,2,2-trifluoro-1-(2-hexan-2-ylpyrrolidin-1-yl)-N-phenylmethoxyethanimine (PubChem CID 162414091) has the molecular formula C19H27F3N2O and a molecular weight of 356.43 g/mol. Its IUPAC name is (E)-2,2,2-trifluoro-1-(2-hexan-2-ylpyrrolidin-1-yl)-N-phenylmethoxyethanimine.
| Compound Name | (E)-2,2,2-trifluoro-1-(2-hexan-2-ylpyrrolidin-1-yl)-N-phenylmethoxyethanimine |
|---|---|
| PubChem CID | 162414091 |
| Molecular Formula | C19H27F3N2O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (E)-2,2,2-trifluoro-1-(2-hexan-2-ylpyrrolidin-1-yl)-N-phenylmethoxyethanimine |
| SMILES | CCCCC(C)C1CCCN1/C(=N/OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H27F3N2O/c1-3-4-9-15(2)17-12-8-13-24(17)18(19(20,21)22)23-25-14-16-10-6-5-7-11-16/h5-7,10-11,15,17H,3-4,8-9,12-14H2,1-2H3/b23-18+ |
| InChIKey | RHOJJPMOSSTRHH-PTGBLXJZSA-N |
| XLogP | 5.37 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|