C24H29F3N2O — CID 162414087
(E)-1-[4,4-dimethyl-2-[2-(4-methylphenyl)ethyl]pyrrolidin-1-yl]-2,2,2-trifluoro-N-phenylmethoxyethanimine (PubChem CID 162414087) has the molecular formula C24H29F3N2O and a molecular weight of 418.50 g/mol. Its IUPAC name is (E)-1-[4,4-dimethyl-2-[2-(4-methylphenyl)ethyl]pyrrolidin-1-yl]-2,2,2-trifluoro-N-phenylmethoxyethanimine.
| Compound Name | (E)-1-[4,4-dimethyl-2-[2-(4-methylphenyl)ethyl]pyrrolidin-1-yl]-2,2,2-trifluoro-N-phenylmethoxyethanimine |
|---|---|
| PubChem CID | 162414087 |
| Molecular Formula | C24H29F3N2O |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | (E)-1-[4,4-dimethyl-2-[2-(4-methylphenyl)ethyl]pyrrolidin-1-yl]-2,2,2-trifluoro-N-phenylmethoxyethanimine |
| SMILES | Cc1ccc(CCC2CC(C)(C)CN2/C(=N/OCc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H29F3N2O/c1-18-9-11-19(12-10-18)13-14-21-15-23(2,3)17-29(21)22(24(25,26)27)28-30-16-20-7-5-4-6-8-20/h4-12,21H,13-17H2,1-3H3/b28-22+ |
| InChIKey | MONRBEPKZUXRGS-XAYXJRQQSA-N |
| XLogP | 6.12 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|