C31H35F3N2O — CID 162414089
(E)-2,2,2-trifluoro-1-(2-hexyl-4,4-diphenylpyrrolidin-1-yl)-N-phenylmethoxyethanimine (PubChem CID 162414089) has the molecular formula C31H35F3N2O and a molecular weight of 508.63 g/mol. Its IUPAC name is (E)-2,2,2-trifluoro-1-(2-hexyl-4,4-diphenylpyrrolidin-1-yl)-N-phenylmethoxyethanimine.
| Compound Name | (E)-2,2,2-trifluoro-1-(2-hexyl-4,4-diphenylpyrrolidin-1-yl)-N-phenylmethoxyethanimine |
|---|---|
| PubChem CID | 162414089 |
| Molecular Formula | C31H35F3N2O |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | (E)-2,2,2-trifluoro-1-(2-hexyl-4,4-diphenylpyrrolidin-1-yl)-N-phenylmethoxyethanimine |
| SMILES | CCCCCCC1CC(c2ccccc2)(c2ccccc2)CN1/C(=N/OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C31H35F3N2O/c1-2-3-4-14-21-28-22-30(26-17-10-6-11-18-26,27-19-12-7-13-20-27)24-36(28)29(31(32,33)34)35-37-23-25-15-8-5-9-16-25/h5-13,15-20,28H,2-4,14,21-24H2,1H3/b35-29+ |
| InChIKey | RIGOLGRPJGLGDN-OZMGXUMRSA-N |
| XLogP | 8.11 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|