C19H22N2O2 — CID 11461066
(E)-5-methyl-N,1-bis(phenylmethoxy)pyrrolidin-2-imine (PubChem CID 11461066) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (E)-5-methyl-N,1-bis(phenylmethoxy)pyrrolidin-2-imine.
| Compound Name | (E)-5-methyl-N,1-bis(phenylmethoxy)pyrrolidin-2-imine |
|---|---|
| PubChem CID | 11461066 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (E)-5-methyl-N,1-bis(phenylmethoxy)pyrrolidin-2-imine |
| SMILES | CC1CC/C(=N\OCc2ccccc2)N1OCc1ccccc1 |
| InChI | InChI=1S/C19H22N2O2/c1-16-12-13-19(20-22-14-17-8-4-2-5-9-17)21(16)23-15-18-10-6-3-7-11-18/h2-11,16H,12-15H2,1H3/b20-19+ |
| InChIKey | YSACDKXIKHANFO-FMQUCBEESA-N |
| XLogP | 4.13 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|