C18H27N3O — CID 145473011
1-N-methyl-3-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxy-1-N-(pyridin-3-ylmethyl)propane-1,2-diamine (PubChem CID 145473011) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is 1-N-methyl-3-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxy-1-N-(pyridin-3-ylmethyl)propane-1,2-diamine.
| Compound Name | 1-N-methyl-3-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxy-1-N-(pyridin-3-ylmethyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 145473011 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 1-N-methyl-3-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxy-1-N-(pyridin-3-ylmethyl)propane-1,2-diamine |
| SMILES | C=C/C(C)=C\C(=C/C)OCC(N)CN(C)Cc1cccnc1 |
| InChI | InChI=1S/C18H27N3O/c1-5-15(3)10-18(6-2)22-14-17(19)13-21(4)12-16-8-7-9-20-11-16/h5-11,17H,1,12-14,19H2,2-4H3/b15-10-,18-6+ |
| InChIKey | YLSASGXMLVZLDS-XNLKGXRVSA-N |
| XLogP | 2.89 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|