C23H42N2O — CID 145472931
ethane;3-ethylpyridine;1-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxybutan-2-amine (PubChem CID 145472931) has the molecular formula C23H42N2O and a molecular weight of 362.60 g/mol. Its IUPAC name is ethane;3-ethylpyridine;1-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxybutan-2-amine.
| Compound Name | ethane;3-ethylpyridine;1-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxybutan-2-amine |
|---|---|
| PubChem CID | 145472931 |
| Molecular Formula | C23H42N2O |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.33 |
| IUPAC Name | ethane;3-ethylpyridine;1-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxybutan-2-amine |
| SMILES | C=C/C(C)=C\C(=C/C)OCC(N)CC.CC.CC.CCc1cccnc1 |
| InChI | InChI=1S/C12H21NO.C7H9N.2C2H6/c1-5-10(4)8-12(7-3)14-9-11(13)6-2;1-2-7-4-3-5-8-6-7;2*1-2/h5,7-8,11H,1,6,9,13H2,2-4H3;3-6H,2H2,1H3;2*1-2H3/b10-8-,12-7+;;; |
| InChIKey | DFOVTQPOCUGIFJ-VMGOKYLISA-N |
| XLogP | 6.47 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|