C33H19NO3S — CID 145474352
1-(furan-2-yl)-4-phenyl-8-pyridin-3-yl-5-thiophen-2-ylanthracene-9,10-dione (PubChem CID 145474352) has the molecular formula C33H19NO3S and a molecular weight of 509.59 g/mol. Its IUPAC name is 1-(furan-2-yl)-4-phenyl-8-pyridin-3-yl-5-thiophen-2-ylanthracene-9,10-dione.
| Compound Name | 1-(furan-2-yl)-4-phenyl-8-pyridin-3-yl-5-thiophen-2-ylanthracene-9,10-dione |
|---|---|
| PubChem CID | 145474352 |
| Molecular Formula | C33H19NO3S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 1-(furan-2-yl)-4-phenyl-8-pyridin-3-yl-5-thiophen-2-ylanthracene-9,10-dione |
| SMILES | O=C1c2c(-c3cccnc3)ccc(-c3cccs3)c2C(=O)c2c(-c3ccccc3)ccc(-c3ccco3)c21 |
| InChI | InChI=1S/C33H19NO3S/c35-32-29-23(21-9-4-16-34-19-21)13-15-25(27-11-6-18-38-27)31(29)33(36)28-22(20-7-2-1-3-8-20)12-14-24(30(28)32)26-10-5-17-37-26/h1-19H |
| InChIKey | PYJUQCNPTFDYQW-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|