C32H34N2O3S — CID 21045711
5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)-N-(pyridin-3-ylmethyl)-N-(thiophen-3-ylmethyl)furan-2-carboxamide (PubChem CID 21045711) has the molecular formula C32H34N2O3S and a molecular weight of 526.70 g/mol. Its IUPAC name is 5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)-N-(pyridin-3-ylmethyl)-N-(thiophen-3-ylmethyl)furan-2-carboxamide.
| Compound Name | 5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)-N-(pyridin-3-ylmethyl)-N-(thiophen-3-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 21045711 |
| Molecular Formula | C32H34N2O3S |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)-N-(pyridin-3-ylmethyl)-N-(thiophen-3-ylmethyl)furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1C(=O)c1ccc(C(=O)N(Cc3cccnc3)Cc3ccsc3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C32H34N2O3S/c1-21-15-25-26(32(4,5)12-11-31(25,2)3)16-24(21)29(35)27-8-9-28(37-27)30(36)34(19-23-10-14-38-20-23)18-22-7-6-13-33-17-22/h6-10,13-17,20H,11-12,18-19H2,1-5H3 |
| InChIKey | RPAOQKMZNNBOPS-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |