C35H37F3N2O2 — CID 21045816
5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(pyridin-3-ylmethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]furan-2-carboxamide (PubChem CID 21045816) has the molecular formula C35H37F3N2O2 and a molecular weight of 574.69 g/mol. Its IUPAC name is 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(pyridin-3-ylmethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]furan-2-carboxamide.
| Compound Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(pyridin-3-ylmethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21045816 |
| Molecular Formula | C35H37F3N2O2 |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(pyridin-3-ylmethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)N(Cc3cccnc3)Cc3cccc(C(F)(F)F)c3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C35H37F3N2O2/c1-23-16-29-30(34(4,5)14-13-33(29,2)3)19-26(23)18-28-11-12-31(42-28)32(41)40(22-25-9-7-15-39-20-25)21-24-8-6-10-27(17-24)35(36,37)38/h6-12,15-17,19-20H,13-14,18,21-22H2,1-5H3 |
| InChIKey | FGLWZPYPMHDUCS-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |