C34H37FN2O2 — CID 21047348
N-[(2-fluorophenyl)methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(pyridin-3-ylmethyl)furan-2-carboxamide (PubChem CID 21047348) has the molecular formula C34H37FN2O2 and a molecular weight of 524.68 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(pyridin-3-ylmethyl)furan-2-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(pyridin-3-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 21047348 |
| Molecular Formula | C34H37FN2O2 |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(pyridin-3-ylmethyl)furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)N(Cc3cccnc3)Cc3ccccc3F)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C34H37FN2O2/c1-23-17-28-29(34(4,5)15-14-33(28,2)3)19-26(23)18-27-12-13-31(39-27)32(38)37(21-24-9-8-16-36-20-24)22-25-10-6-7-11-30(25)35/h6-13,16-17,19-20H,14-15,18,21-22H2,1-5H3 |
| InChIKey | USFGNKCNMVFWNA-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |