C32H36N2O2S — CID 21045815
5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(pyridin-3-ylmethyl)-N-(thiophen-3-ylmethyl)furan-2-carboxamide (PubChem CID 21045815) has the molecular formula C32H36N2O2S and a molecular weight of 512.72 g/mol. Its IUPAC name is 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(pyridin-3-ylmethyl)-N-(thiophen-3-ylmethyl)furan-2-carboxamide.
| Compound Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(pyridin-3-ylmethyl)-N-(thiophen-3-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 21045815 |
| Molecular Formula | C32H36N2O2S |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(pyridin-3-ylmethyl)-N-(thiophen-3-ylmethyl)furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)N(Cc3cccnc3)Cc3ccsc3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C32H36N2O2S/c1-22-15-27-28(32(4,5)12-11-31(27,2)3)17-25(22)16-26-8-9-29(36-26)30(35)34(20-24-10-14-37-21-24)19-23-7-6-13-33-18-23/h6-10,13-15,17-18,21H,11-12,16,19-20H2,1-5H3 |
| InChIKey | KJJHZBCWCZBRBZ-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |