C22H25N2O7+ — CID 145476443
(2-hydroxy-4-methoxycarbonylphenyl)-[3-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]-methylideneazanium (PubChem CID 145476443) has the molecular formula C22H25N2O7+ and a molecular weight of 429.45 g/mol. Its IUPAC name is (2-hydroxy-4-methoxycarbonylphenyl)-[3-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]-methylideneazanium.
| Compound Name | (2-hydroxy-4-methoxycarbonylphenyl)-[3-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]-methylideneazanium |
|---|---|
| PubChem CID | 145476443 |
| Molecular Formula | C22H25N2O7+ |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | (2-hydroxy-4-methoxycarbonylphenyl)-[3-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]-methylideneazanium |
| SMILES | C=[N+](C(=O)c1ccc(NC(=O)OC(C)(C)C)c(OC)c1)c1ccc(C(=O)OC)cc1O |
| InChI | InChI=1S/C22H24N2O7/c1-22(2,3)31-21(28)23-15-9-7-13(12-18(15)29-5)19(26)24(4)16-10-8-14(11-17(16)25)20(27)30-6/h7-12H,4H2,1-3,5-6H3,(H-,23,25,26,28)/p+1 |
| InChIKey | PGIJULJVEKDEBG-UHFFFAOYSA-O |
| XLogP | 3.72 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|