C23H22FNO4S — CID 145477050
ethyl 2-[3-[[4-(4-fluoro-2-methylphenyl)phenyl]sulfonylamino]phenyl]acetate (PubChem CID 145477050) has the molecular formula C23H22FNO4S and a molecular weight of 427.50 g/mol. Its IUPAC name is ethyl 2-[3-[[4-(4-fluoro-2-methylphenyl)phenyl]sulfonylamino]phenyl]acetate.
| Compound Name | ethyl 2-[3-[[4-(4-fluoro-2-methylphenyl)phenyl]sulfonylamino]phenyl]acetate |
|---|---|
| PubChem CID | 145477050 |
| Molecular Formula | C23H22FNO4S |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | ethyl 2-[3-[[4-(4-fluoro-2-methylphenyl)phenyl]sulfonylamino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1cccc(NS(=O)(=O)c2ccc(-c3ccc(F)cc3C)cc2)c1 |
| InChI | InChI=1S/C23H22FNO4S/c1-3-29-23(26)15-17-5-4-6-20(14-17)25-30(27,28)21-10-7-18(8-11-21)22-12-9-19(24)13-16(22)2/h4-14,25H,3,15H2,1-2H3 |
| InChIKey | NPQVQYQCVKVZSK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |