C17H21NO2 — CID 14547776
ethyl 4-[(4E)-4-benzylidene-2,3-dihydropyrrol-5-yl]butanoate (PubChem CID 14547776) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is ethyl 4-[(4E)-4-benzylidene-2,3-dihydropyrrol-5-yl]butanoate.
| Compound Name | ethyl 4-[(4E)-4-benzylidene-2,3-dihydropyrrol-5-yl]butanoate |
|---|---|
| PubChem CID | 14547776 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | ethyl 4-[(4E)-4-benzylidene-2,3-dihydropyrrol-5-yl]butanoate |
| SMILES | CCOC(=O)CCCC1=NCC/C1=C\c1ccccc1 |
| InChI | InChI=1S/C17H21NO2/c1-2-20-17(19)10-6-9-16-15(11-12-18-16)13-14-7-4-3-5-8-14/h3-5,7-8,13H,2,6,9-12H2,1H3/b15-13+ |
| InChIKey | MMYZPRLELQRFSQ-FYWRMAATSA-N |
| XLogP | 3.65 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |