C25H30FN3S — CID 145479836
7-[(3-fluorophenyl)methyl]-2-[(E)-3-[[(1R)-1-phenylethyl]amino]sulfanylprop-2-enimidoyl]cyclohepten-1-amine (PubChem CID 145479836) has the molecular formula C25H30FN3S and a molecular weight of 423.60 g/mol. Its IUPAC name is 7-[(3-fluorophenyl)methyl]-2-[(E)-3-[[(1R)-1-phenylethyl]amino]sulfanylprop-2-enimidoyl]cyclohepten-1-amine.
| Compound Name | 7-[(3-fluorophenyl)methyl]-2-[(E)-3-[[(1R)-1-phenylethyl]amino]sulfanylprop-2-enimidoyl]cyclohepten-1-amine |
|---|---|
| PubChem CID | 145479836 |
| Molecular Formula | C25H30FN3S |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 7-[(3-fluorophenyl)methyl]-2-[(E)-3-[[(1R)-1-phenylethyl]amino]sulfanylprop-2-enimidoyl]cyclohepten-1-amine |
| SMILES | [H]/N=C(\C=C\SN[C@H](C)c1ccccc1)C1=C(N)C(Cc2cccc(F)c2)CCCC1 |
| InChI | InChI=1S/C25H30FN3S/c1-18(20-9-3-2-4-10-20)29-30-15-14-24(27)23-13-6-5-11-21(25(23)28)16-19-8-7-12-22(26)17-19/h2-4,7-10,12,14-15,17-18,21,27,29H,5-6,11,13,16,28H2,1H3/b15-14+,27-24+/t18-,21?/m1/s1 |
| InChIKey | QNCPSOSHBONLLE-ZMTPVOEVSA-N |
| XLogP | 6.30 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|