C26H31F3N4O4S — CID 145480421
(2S)-3-cyclohexyl-N-[C-ethynyl-N-[(Z)-prop-1-enyl]carbonimidoyl]-2-[2-oxo-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide (PubChem CID 145480421) has the molecular formula C26H31F3N4O4S and a molecular weight of 552.62 g/mol. Its IUPAC name is (2S)-3-cyclohexyl-N-[C-ethynyl-N-[(Z)-prop-1-enyl]carbonimidoyl]-2-[2-oxo-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide.
| Compound Name | (2S)-3-cyclohexyl-N-[C-ethynyl-N-[(Z)-prop-1-enyl]carbonimidoyl]-2-[2-oxo-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 145480421 |
| Molecular Formula | C26H31F3N4O4S |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | (2S)-3-cyclohexyl-N-[C-ethynyl-N-[(Z)-prop-1-enyl]carbonimidoyl]-2-[2-oxo-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide |
| SMILES | C#C/C(=N\C=C/C)NC(=O)[C@H](CC1CCCCC1)N1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1=O |
| InChI | InChI=1S/C26H31F3N4O4S/c1-3-13-30-23(4-2)31-25(35)22(16-19-9-6-5-7-10-19)33-15-14-32(18-24(33)34)38(36,37)21-12-8-11-20(17-21)26(27,28)29/h2-3,8,11-13,17,19,22H,5-7,9-10,14-16,18H2,1H3,(H,30,31,35)/b13-3-/t22-/m0/s1 |
| InChIKey | XACQRANFRNPRPR-OUJUQZFUSA-N |
| XLogP | 3.56 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|