C19H23F3N4O3S — CID 133424037
1-(2-methylpropyl)-3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrazin-2-one (PubChem CID 133424037) has the molecular formula C19H23F3N4O3S and a molecular weight of 444.48 g/mol. Its IUPAC name is 1-(2-methylpropyl)-3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrazin-2-one.
| Compound Name | 1-(2-methylpropyl)-3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrazin-2-one |
|---|---|
| PubChem CID | 133424037 |
| Molecular Formula | C19H23F3N4O3S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 1-(2-methylpropyl)-3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrazin-2-one |
| SMILES | CC(C)Cn1ccnc(N2CCN(S(=O)(=O)c3cccc(C(F)(F)F)c3)CC2)c1=O |
| InChI | InChI=1S/C19H23F3N4O3S/c1-14(2)13-25-7-6-23-17(18(25)27)24-8-10-26(11-9-24)30(28,29)16-5-3-4-15(12-16)19(20,21)22/h3-7,12,14H,8-11,13H2,1-2H3 |
| InChIKey | WBGRKMUGDUCYMP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |