C30H29NO4 — CID 145482146
7-methoxy-1,9-dimethyl-3,6-diphenyl-8-propylcarbazole-2,4,5-triol (PubChem CID 145482146) has the molecular formula C30H29NO4 and a molecular weight of 467.57 g/mol. Its IUPAC name is 7-methoxy-1,9-dimethyl-3,6-diphenyl-8-propylcarbazole-2,4,5-triol.
| Compound Name | 7-methoxy-1,9-dimethyl-3,6-diphenyl-8-propylcarbazole-2,4,5-triol |
|---|---|
| PubChem CID | 145482146 |
| Molecular Formula | C30H29NO4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 7-methoxy-1,9-dimethyl-3,6-diphenyl-8-propylcarbazole-2,4,5-triol |
| SMILES | CCCc1c(OC)c(-c2ccccc2)c(O)c2c3c(O)c(-c4ccccc4)c(O)c(C)c3n(C)c12 |
| InChI | InChI=1S/C30H29NO4/c1-5-12-20-26-24(29(34)22(30(20)35-4)19-15-10-7-11-16-19)23-25(31(26)3)17(2)27(32)21(28(23)33)18-13-8-6-9-14-18/h6-11,13-16,32-34H,5,12H2,1-4H3 |
| InChIKey | JGBDMPZMEFXPMD-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |