C22H20O3 — CID 141218224
(3,4-dimethoxy-12-methyl-5-phenyl-11-tricyclo[5.3.1.12,6]dodeca-1(10),2,4,6(12),7(11),8-hexaenyl)methanol (PubChem CID 141218224) has the molecular formula C22H20O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is (3,4-dimethoxy-12-methyl-5-phenyl-11-tricyclo[5.3.1.12,6]dodeca-1(10),2,4,6(12),7(11),8-hexaenyl)methanol.
| Compound Name | (3,4-dimethoxy-12-methyl-5-phenyl-11-tricyclo[5.3.1.12,6]dodeca-1(10),2,4,6(12),7(11),8-hexaenyl)methanol |
|---|---|
| PubChem CID | 141218224 |
| Molecular Formula | C22H20O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (3,4-dimethoxy-12-methyl-5-phenyl-11-tricyclo[5.3.1.12,6]dodeca-1(10),2,4,6(12),7(11),8-hexaenyl)methanol |
| SMILES | COc1c(OC)c2c(C)c(c1-c1ccccc1)c1cccc2c1CO |
| InChI | InChI=1S/C22H20O3/c1-13-18-15-10-7-11-16(17(15)12-23)19(13)21(24-2)22(25-3)20(18)14-8-5-4-6-9-14/h4-11,23H,12H2,1-3H3 |
| InChIKey | MEPYUUOCODVFKU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |