C43H32N2S3 — CID 145482244
[9,10-bis[4-(1,3-benzothiazol-2-yl)phenyl]anthracen-2-yl]-trimethyl-λ4-sulfane (PubChem CID 145482244) has the molecular formula C43H32N2S3 and a molecular weight of 672.94 g/mol. Its IUPAC name is [9,10-bis[4-(1,3-benzothiazol-2-yl)phenyl]anthracen-2-yl]-trimethyl-λ4-sulfane.
| Compound Name | [9,10-bis[4-(1,3-benzothiazol-2-yl)phenyl]anthracen-2-yl]-trimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 145482244 |
| Molecular Formula | C43H32N2S3 |
| Molecular Weight | 672.94 g/mol |
| Exact Mass | 672.17 |
| IUPAC Name | [9,10-bis[4-(1,3-benzothiazol-2-yl)phenyl]anthracen-2-yl]-trimethyl-λ4-sulfane |
| SMILES | CS(C)(C)c1ccc2c(-c3ccc(-c4nc5ccccc5s4)cc3)c3ccccc3c(-c3ccc(-c4nc5ccccc5s4)cc3)c2c1 |
| InChI | InChI=1S/C43H32N2S3/c1-48(2,3)31-24-25-34-35(26-31)41(28-18-22-30(23-19-28)43-45-37-13-7-9-15-39(37)47-43)33-11-5-4-10-32(33)40(34)27-16-20-29(21-17-27)42-44-36-12-6-8-14-38(36)46-42/h4-26H,1-3H3 |
| InChIKey | PQDSRMQFERIXCZ-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.94 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|