C29H39N3O6S2 — CID 145483803
[(2S)-5-oxohexan-2-yl] N-[(2S,3R)-4-[1,3-benzothiazol-6-ylsulfonyl(pentyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 145483803) has the molecular formula C29H39N3O6S2 and a molecular weight of 589.78 g/mol. Its IUPAC name is [(2S)-5-oxohexan-2-yl] N-[(2S,3R)-4-[1,3-benzothiazol-6-ylsulfonyl(pentyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(2S)-5-oxohexan-2-yl] N-[(2S,3R)-4-[1,3-benzothiazol-6-ylsulfonyl(pentyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 145483803 |
| Molecular Formula | C29H39N3O6S2 |
| Molecular Weight | 589.78 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | [(2S)-5-oxohexan-2-yl] N-[(2S,3R)-4-[1,3-benzothiazol-6-ylsulfonyl(pentyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CCCCCN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@@H](C)CCC(C)=O)S(=O)(=O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C29H39N3O6S2/c1-4-5-9-16-32(40(36,37)24-14-15-25-28(18-24)39-20-30-25)19-27(34)26(17-23-10-7-6-8-11-23)31-29(35)38-22(3)13-12-21(2)33/h6-8,10-11,14-15,18,20,22,26-27,34H,4-5,9,12-13,16-17,19H2,1-3H3,(H,31,35)/t22-,26-,27+/m0/s1 |
| InChIKey | KRCYPSCTDIXRIA-WDDWZANVSA-N |
| XLogP | 4.93 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.78 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|