C27H34N4O5S2 — CID 24878978
1-N'-[(2S,3R)-4-[1,3-benzothiazol-6-ylsulfonyl(pentyl)amino]-3-hydroxy-1-phenylbutan-2-yl]cyclopropane-1,1-dicarboxamide (PubChem CID 24878978) has the molecular formula C27H34N4O5S2 and a molecular weight of 558.73 g/mol. Its IUPAC name is 1-N'-[(2S,3R)-4-[1,3-benzothiazol-6-ylsulfonyl(pentyl)amino]-3-hydroxy-1-phenylbutan-2-yl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[(2S,3R)-4-[1,3-benzothiazol-6-ylsulfonyl(pentyl)amino]-3-hydroxy-1-phenylbutan-2-yl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 24878978 |
| Molecular Formula | C27H34N4O5S2 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 1-N'-[(2S,3R)-4-[1,3-benzothiazol-6-ylsulfonyl(pentyl)amino]-3-hydroxy-1-phenylbutan-2-yl]cyclopropane-1,1-dicarboxamide |
| SMILES | CCCCCN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)C1(C(N)=O)CC1)S(=O)(=O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C27H34N4O5S2/c1-2-3-7-14-31(38(35,36)20-10-11-21-24(16-20)37-18-29-21)17-23(32)22(15-19-8-5-4-6-9-19)30-26(34)27(12-13-27)25(28)33/h4-6,8-11,16,18,22-23,32H,2-3,7,12-15,17H2,1H3,(H2,28,33)(H,30,34)/t22-,23+/m0/s1 |
| InChIKey | CAQBHFQHVSOLDD-XZOQPEGZSA-N |
| XLogP | 2.83 |
| TPSA | 142.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|