C29H43N3O5S — CID 58358964
2-acetamido-N-[(2S,3R)-3-hydroxy-4-[(4-methylphenyl)sulfonyl-pentylamino]-1-phenylbutan-2-yl]-3-methylbutanamide (PubChem CID 58358964) has the molecular formula C29H43N3O5S and a molecular weight of 545.75 g/mol. Its IUPAC name is 2-acetamido-N-[(2S,3R)-3-hydroxy-4-[(4-methylphenyl)sulfonyl-pentylamino]-1-phenylbutan-2-yl]-3-methylbutanamide.
| Compound Name | 2-acetamido-N-[(2S,3R)-3-hydroxy-4-[(4-methylphenyl)sulfonyl-pentylamino]-1-phenylbutan-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 58358964 |
| Molecular Formula | C29H43N3O5S |
| Molecular Weight | 545.75 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | 2-acetamido-N-[(2S,3R)-3-hydroxy-4-[(4-methylphenyl)sulfonyl-pentylamino]-1-phenylbutan-2-yl]-3-methylbutanamide |
| SMILES | CCCCCN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)C(NC(C)=O)C(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H43N3O5S/c1-6-7-11-18-32(38(36,37)25-16-14-22(4)15-17-25)20-27(34)26(19-24-12-9-8-10-13-24)31-29(35)28(21(2)3)30-23(5)33/h8-10,12-17,21,26-28,34H,6-7,11,18-20H2,1-5H3,(H,30,33)(H,31,35)/t26-,27+,28?/m0/s1 |
| InChIKey | ROVOOXRSMZLQSH-MDEZFMAYSA-N |
| XLogP | 3.43 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.75 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|