C28H40N4O7S — CID 173083011
[(2S,3S)-1-[[(2S,3R)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamic acid (PubChem CID 173083011) has the molecular formula C28H40N4O7S and a molecular weight of 576.72 g/mol. Its IUPAC name is [(2S,3S)-1-[[(2S,3R)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamic acid.
| Compound Name | [(2S,3S)-1-[[(2S,3R)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 173083011 |
| Molecular Formula | C28H40N4O7S |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | [(2S,3S)-1-[[(2S,3R)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)O)C(=O)N[C@@H](Cc1ccccc1)[C@H](O)CN(CC(C)C)S(=O)(=O)c1ccc(C=NO)cc1 |
| InChI | InChI=1S/C28H40N4O7S/c1-5-20(4)26(31-28(35)36)27(34)30-24(15-21-9-7-6-8-10-21)25(33)18-32(17-19(2)3)40(38,39)23-13-11-22(12-14-23)16-29-37/h6-14,16,19-20,24-26,31,33,37H,5,15,17-18H2,1-4H3,(H,30,34)(H,35,36)/t20-,24-,25+,26-/m0/s1 |
| InChIKey | NFKYHEPDKVHWSH-JTMVAAEOSA-N |
| XLogP | 2.91 |
| TPSA | 168.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|