C25H35N5O9S2 — CID 87454402
[(2R)-1-[[(2S,3R)-3-hydroxy-4-[[4-[(E)-hydroxyiminomethyl]phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-1-oxo-3-sulfamoylpropan-2-yl]carbamic acid (PubChem CID 87454402) has the molecular formula C25H35N5O9S2 and a molecular weight of 613.72 g/mol. Its IUPAC name is [(2R)-1-[[(2S,3R)-3-hydroxy-4-[[4-[(E)-hydroxyiminomethyl]phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-1-oxo-3-sulfamoylpropan-2-yl]carbamic acid.
| Compound Name | [(2R)-1-[[(2S,3R)-3-hydroxy-4-[[4-[(E)-hydroxyiminomethyl]phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-1-oxo-3-sulfamoylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87454402 |
| Molecular Formula | C25H35N5O9S2 |
| Molecular Weight | 613.72 g/mol |
| Exact Mass | 613.19 |
| IUPAC Name | [(2R)-1-[[(2S,3R)-3-hydroxy-4-[[4-[(E)-hydroxyiminomethyl]phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-1-oxo-3-sulfamoylpropan-2-yl]carbamic acid |
| SMILES | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)[C@H](CS(N)(=O)=O)NC(=O)O)S(=O)(=O)c1ccc(/C=N/O)cc1 |
| InChI | InChI=1S/C25H35N5O9S2/c1-17(2)14-30(41(38,39)20-10-8-19(9-11-20)13-27-35)15-23(31)21(12-18-6-4-3-5-7-18)28-24(32)22(29-25(33)34)16-40(26,36)37/h3-11,13,17,21-23,29,31,35H,12,14-16H2,1-2H3,(H,28,32)(H,33,34)(H2,26,36,37)/b27-13+/t21-,22-,23+/m0/s1 |
| InChIKey | HPWPPKCTNDAXSB-FPBDUONMSA-N |
| XLogP | 0.15 |
| TPSA | 228.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.72 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|