C27H38N4O9S2 — CID 173083016
[(2S)-1-[[(2S,3S)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-4-methylsulfonyl-1-oxobutan-2-yl]carbamic acid (PubChem CID 173083016) has the molecular formula C27H38N4O9S2 and a molecular weight of 626.75 g/mol. Its IUPAC name is [(2S)-1-[[(2S,3S)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-4-methylsulfonyl-1-oxobutan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[[(2S,3S)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-4-methylsulfonyl-1-oxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 173083016 |
| Molecular Formula | C27H38N4O9S2 |
| Molecular Weight | 626.75 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | [(2S)-1-[[(2S,3S)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-4-methylsulfonyl-1-oxobutan-2-yl]carbamic acid |
| SMILES | CC(C)CN(C[C@H](O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCS(C)(=O)=O)NC(=O)O)S(=O)(=O)c1ccc(C=NO)cc1 |
| InChI | InChI=1S/C27H38N4O9S2/c1-19(2)17-31(42(39,40)22-11-9-21(10-12-22)16-28-36)18-25(32)24(15-20-7-5-4-6-8-20)29-26(33)23(30-27(34)35)13-14-41(3,37)38/h4-12,16,19,23-25,30,32,36H,13-15,17-18H2,1-3H3,(H,29,33)(H,34,35)/t23-,24-,25-/m0/s1 |
| InChIKey | UIBHWWKSXWFCJF-SDHOMARFSA-N |
| XLogP | 1.30 |
| TPSA | 202.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.75 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|