C35H46N4O7S — CID 173028297
[(2S)-1-[[(2S,3S)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-3,3-dimethyl-1-oxo-5-phenylpentan-2-yl]carbamic acid (PubChem CID 173028297) has the molecular formula C35H46N4O7S and a molecular weight of 666.84 g/mol. Its IUPAC name is [(2S)-1-[[(2S,3S)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-3,3-dimethyl-1-oxo-5-phenylpentan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[[(2S,3S)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-3,3-dimethyl-1-oxo-5-phenylpentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 173028297 |
| Molecular Formula | C35H46N4O7S |
| Molecular Weight | 666.84 g/mol |
| Exact Mass | 666.31 |
| IUPAC Name | [(2S)-1-[[(2S,3S)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-3,3-dimethyl-1-oxo-5-phenylpentan-2-yl]carbamic acid |
| SMILES | CC(C)CN(C[C@H](O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)O)C(C)(C)CCc1ccccc1)S(=O)(=O)c1ccc(C=NO)cc1 |
| InChI | InChI=1S/C35H46N4O7S/c1-25(2)23-39(47(45,46)29-17-15-28(16-18-29)22-36-44)24-31(40)30(21-27-13-9-6-10-14-27)37-33(41)32(38-34(42)43)35(3,4)20-19-26-11-7-5-8-12-26/h5-18,22,25,30-32,38,40,44H,19-21,23-24H2,1-4H3,(H,37,41)(H,42,43)/t30-,31-,32+/m0/s1 |
| InChIKey | PIDMAFKXDRCRQA-OWHBQTKESA-N |
| XLogP | 4.53 |
| TPSA | 168.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.84 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|