C29H42N4O7S — CID 173028881
[(2S)-1-[[(2S,3S)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-3,3-dimethyl-1-oxobutan-2-yl]-methylcarbamic acid (PubChem CID 173028881) has the molecular formula C29H42N4O7S and a molecular weight of 590.74 g/mol. Its IUPAC name is [(2S)-1-[[(2S,3S)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-3,3-dimethyl-1-oxobutan-2-yl]-methylcarbamic acid.
| Compound Name | [(2S)-1-[[(2S,3S)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-3,3-dimethyl-1-oxobutan-2-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 173028881 |
| Molecular Formula | C29H42N4O7S |
| Molecular Weight | 590.74 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | [(2S)-1-[[(2S,3S)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-3,3-dimethyl-1-oxobutan-2-yl]-methylcarbamic acid |
| SMILES | CC(C)CN(C[C@H](O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N(C)C(=O)O)C(C)(C)C)S(=O)(=O)c1ccc(C=NO)cc1 |
| InChI | InChI=1S/C29H42N4O7S/c1-20(2)18-33(41(39,40)23-14-12-22(13-15-23)17-30-38)19-25(34)24(16-21-10-8-7-9-11-21)31-27(35)26(29(3,4)5)32(6)28(36)37/h7-15,17,20,24-26,34,38H,16,18-19H2,1-6H3,(H,31,35)(H,36,37)/t24-,25-,26+/m0/s1 |
| InChIKey | XFIIQVZQCJTCNZ-KKUQBAQOSA-N |
| XLogP | 3.25 |
| TPSA | 159.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.74 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|