C32H48N4O7S — CID 173028728
tert-butyl-[(2S)-1-[[(2S,3R)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamic acid (PubChem CID 173028728) has the molecular formula C32H48N4O7S and a molecular weight of 632.82 g/mol. Its IUPAC name is tert-butyl-[(2S)-1-[[(2S,3R)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[(2S)-1-[[(2S,3R)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 173028728 |
| Molecular Formula | C32H48N4O7S |
| Molecular Weight | 632.82 g/mol |
| Exact Mass | 632.32 |
| IUPAC Name | tert-butyl-[(2S)-1-[[(2S,3R)-3-hydroxy-4-[[4-(hydroxyiminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]amino]-3,3-dimethyl-1-oxobutan-2-yl]carbamic acid |
| SMILES | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N(C(=O)O)C(C)(C)C)C(C)(C)C)S(=O)(=O)c1ccc(C=NO)cc1 |
| InChI | InChI=1S/C32H48N4O7S/c1-22(2)20-35(44(42,43)25-16-14-24(15-17-25)19-33-41)21-27(37)26(18-23-12-10-9-11-13-23)34-29(38)28(31(3,4)5)36(30(39)40)32(6,7)8/h9-17,19,22,26-28,37,41H,18,20-21H2,1-8H3,(H,34,38)(H,39,40)/t26-,27+,28+/m0/s1 |
| InChIKey | LONVIFMDOUZLFA-UPRLRBBYSA-N |
| XLogP | 4.42 |
| TPSA | 159.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.82 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|