C27H23NO6 — CID 145485523
ethyl 4-[2-cyclohepta-1,3,6-trien-1-yl-3-(4-hydroxybenzoyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 145485523) has the molecular formula C27H23NO6 and a molecular weight of 457.48 g/mol. Its IUPAC name is ethyl 4-[2-cyclohepta-1,3,6-trien-1-yl-3-(4-hydroxybenzoyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[2-cyclohepta-1,3,6-trien-1-yl-3-(4-hydroxybenzoyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 145485523 |
| Molecular Formula | C27H23NO6 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | ethyl 4-[2-cyclohepta-1,3,6-trien-1-yl-3-(4-hydroxybenzoyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C(=O)C(C(=O)c3ccc(O)cc3)C2C2=CC=CCC=C2)cc1 |
| InChI | InChI=1S/C27H23NO6/c1-2-34-27(33)19-9-13-20(14-10-19)28-23(17-7-5-3-4-6-8-17)22(25(31)26(28)32)24(30)18-11-15-21(29)16-12-18/h3,5-16,22-23,29H,2,4H2,1H3 |
| InChIKey | DHXIAZMOVGPXSJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|