C27H24N2O7 — CID 123653337
ethyl 4-[2-(4-aminooxy-2-methoxyphenyl)-3-benzoyl-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 123653337) has the molecular formula C27H24N2O7 and a molecular weight of 488.50 g/mol. Its IUPAC name is ethyl 4-[2-(4-aminooxy-2-methoxyphenyl)-3-benzoyl-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[2-(4-aminooxy-2-methoxyphenyl)-3-benzoyl-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 123653337 |
| Molecular Formula | C27H24N2O7 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | ethyl 4-[2-(4-aminooxy-2-methoxyphenyl)-3-benzoyl-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C(=O)C(C(=O)c3ccccc3)C2c2ccc(ON)cc2OC)cc1 |
| InChI | InChI=1S/C27H24N2O7/c1-3-35-27(33)17-9-11-18(12-10-17)29-23(20-14-13-19(36-28)15-21(20)34-2)22(25(31)26(29)32)24(30)16-7-5-4-6-8-16/h4-15,22-23H,3,28H2,1-2H3 |
| InChIKey | QBOVLEUCCNWERG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|