About 2-ethenylfuran;1-phenylethylbenzene
2-ethenylfuran;1-phenylethylbenzene (PubChem CID 145486399) has the molecular formula C20H20O
and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-ethenylfuran;1-phenylethylbenzene.
Molecular Properties
| Compound Name | 2-ethenylfuran;1-phenylethylbenzene |
| PubChem CID | 145486399 |
| Molecular Formula | C20H20O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-ethenylfuran;1-phenylethylbenzene |
| SMILES | C=Cc1ccco1.CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H14.C6H6O/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-2-6-4-3-5-7-6/h2-12H,1H3;2-5H,1H2 |
| InChIKey | SEAWFBDOKFYUFE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethenylfuran;1-phenylethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylfuran;1-phenylethylbenzene?
The IUPAC name of 2-ethenylfuran;1-phenylethylbenzene (CID 145486399) is 2-ethenylfuran;1-phenylethylbenzene.
What is the SMILES notation for 2-ethenylfuran;1-phenylethylbenzene?
The canonical SMILES for 2-ethenylfuran;1-phenylethylbenzene is C=Cc1ccco1.CC(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-ethenylfuran;1-phenylethylbenzene?
The InChIKey is SEAWFBDOKFYUFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C6H6O/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-2-6-4-3-5-7-6/h2-12H,1H3;2-5H,1H2.
What are the key properties of 2-ethenylfuran;1-phenylethylbenzene?
2-ethenylfuran;1-phenylethylbenzene has a molecular weight of 276.38 g/mol, XLogP of 5.76, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylfuran;1-phenylethylbenzene is sourced from PubChem (CID 145486399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).