C26H31NO — CID 145486786
1-ethyl-3-(4-phenylbutyl)benzene;4-methylbenzamide (PubChem CID 145486786) has the molecular formula C26H31NO and a molecular weight of 373.54 g/mol. Its IUPAC name is 1-ethyl-3-(4-phenylbutyl)benzene;4-methylbenzamide.
| Compound Name | 1-ethyl-3-(4-phenylbutyl)benzene;4-methylbenzamide |
|---|---|
| PubChem CID | 145486786 |
| Molecular Formula | C26H31NO |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 1-ethyl-3-(4-phenylbutyl)benzene;4-methylbenzamide |
| SMILES | CCc1cccc(CCCCc2ccccc2)c1.Cc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C18H22.C8H9NO/c1-2-16-13-8-14-18(15-16)12-7-6-11-17-9-4-3-5-10-17;1-6-2-4-7(5-3-6)8(9)10/h3-5,8-10,13-15H,2,6-7,11-12H2,1H3;2-5H,1H3,(H2,9,10) |
| InChIKey | VIWRLOJXUGSSES-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|