C16H30N2 — CID 145487043
ethane;1,3,4-trimethylpyrrolo[2,3-b]pyridine (PubChem CID 145487043) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is ethane;1,3,4-trimethylpyrrolo[2,3-b]pyridine.
| Compound Name | ethane;1,3,4-trimethylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 145487043 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | ethane;1,3,4-trimethylpyrrolo[2,3-b]pyridine |
| SMILES | CC.CC.CC.Cc1ccnc2c1c(C)cn2C |
| InChI | InChI=1S/C10H12N2.3C2H6/c1-7-4-5-11-10-9(7)8(2)6-12(10)3;3*1-2/h4-6H,1-3H3;3*1-2H3 |
| InChIKey | UEXMUJWXUWRADL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |