C24H28N4O2 — CID 145487474
N-hydroxy-2-phenyl-2-[4-[1-[(Z)-[(Z)-2-phenylbut-2-enylidene]amino]ethenyl]piperazin-1-yl]acetamide (PubChem CID 145487474) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-hydroxy-2-phenyl-2-[4-[1-[(Z)-[(Z)-2-phenylbut-2-enylidene]amino]ethenyl]piperazin-1-yl]acetamide.
| Compound Name | N-hydroxy-2-phenyl-2-[4-[1-[(Z)-[(Z)-2-phenylbut-2-enylidene]amino]ethenyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 145487474 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-hydroxy-2-phenyl-2-[4-[1-[(Z)-[(Z)-2-phenylbut-2-enylidene]amino]ethenyl]piperazin-1-yl]acetamide |
| SMILES | C=C(/N=C\C(=C/C)c1ccccc1)N1CCN(C(C(=O)NO)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H28N4O2/c1-3-20(21-10-6-4-7-11-21)18-25-19(2)27-14-16-28(17-15-27)23(24(29)26-30)22-12-8-5-9-13-22/h3-13,18,23,30H,2,14-17H2,1H3,(H,26,29)/b20-3+,25-18- |
| InChIKey | QIIOOXKGDIXPMW-IINHRQFFSA-N |
| XLogP | 3.50 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|