C20H21F2N3O2 — CID 145487876
N,3-difluoro-N-phenyl-5-(3-pyrrolidin-1-ylpropanoylamino)benzamide (PubChem CID 145487876) has the molecular formula C20H21F2N3O2 and a molecular weight of 373.40 g/mol. Its IUPAC name is N,3-difluoro-N-phenyl-5-(3-pyrrolidin-1-ylpropanoylamino)benzamide.
| Compound Name | N,3-difluoro-N-phenyl-5-(3-pyrrolidin-1-ylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 145487876 |
| Molecular Formula | C20H21F2N3O2 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N,3-difluoro-N-phenyl-5-(3-pyrrolidin-1-ylpropanoylamino)benzamide |
| SMILES | O=C(CCN1CCCC1)Nc1cc(F)cc(C(=O)N(F)c2ccccc2)c1 |
| InChI | InChI=1S/C20H21F2N3O2/c21-16-12-15(20(27)25(22)18-6-2-1-3-7-18)13-17(14-16)23-19(26)8-11-24-9-4-5-10-24/h1-3,6-7,12-14H,4-5,8-11H2,(H,23,26) |
| InChIKey | NULOUTRJWWDUJM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|