About (3-hydroxy-9-iodononyl) 4-hydroxybenzoate
(3-hydroxy-9-iodononyl) 4-hydroxybenzoate (PubChem CID 145488111) has the molecular formula C16H23IO4
and a molecular weight of 406.26 g/mol. Its IUPAC name is (3-hydroxy-9-iodononyl) 4-hydroxybenzoate.
Molecular Properties
| Compound Name | (3-hydroxy-9-iodononyl) 4-hydroxybenzoate |
| PubChem CID | 145488111 |
| Molecular Formula | C16H23IO4 |
| Molecular Weight | 406.26 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | (3-hydroxy-9-iodononyl) 4-hydroxybenzoate |
| SMILES | O=C(OCCC(O)CCCCCCI)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H23IO4/c17-11-4-2-1-3-5-14(18)10-12-21-16(20)13-6-8-15(19)9-7-13/h6-9,14,18-19H,1-5,10-12H2 |
| InChIKey | TVHFKDGESJMFFC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.26 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-9-iodononyl) 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-9-iodononyl) 4-hydroxybenzoate?
The IUPAC name of (3-hydroxy-9-iodononyl) 4-hydroxybenzoate (CID 145488111) is (3-hydroxy-9-iodononyl) 4-hydroxybenzoate.
What is the SMILES notation for (3-hydroxy-9-iodononyl) 4-hydroxybenzoate?
The canonical SMILES for (3-hydroxy-9-iodononyl) 4-hydroxybenzoate is O=C(OCCC(O)CCCCCCI)c1ccc(O)cc1.
What is the InChIKey of (3-hydroxy-9-iodononyl) 4-hydroxybenzoate?
The InChIKey is TVHFKDGESJMFFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23IO4/c17-11-4-2-1-3-5-14(18)10-12-21-16(20)13-6-8-15(19)9-7-13/h6-9,14,18-19H,1-5,10-12H2.
What are the key properties of (3-hydroxy-9-iodononyl) 4-hydroxybenzoate?
(3-hydroxy-9-iodononyl) 4-hydroxybenzoate has a molecular weight of 406.26 g/mol, XLogP of 3.69, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-9-iodononyl) 4-hydroxybenzoate is sourced from PubChem (CID 145488111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).