C20H27N9O2 — CID 145488359
N-[(2S)-5-amino-1-oxo-1-[[(2R)-2-(2H-tetrazol-5-yl)cyclopentyl]amino]pentan-2-yl]-1-methylindazole-4-carboxamide (PubChem CID 145488359) has the molecular formula C20H27N9O2 and a molecular weight of 425.50 g/mol. Its IUPAC name is N-[(2S)-5-amino-1-oxo-1-[[(2R)-2-(2H-tetrazol-5-yl)cyclopentyl]amino]pentan-2-yl]-1-methylindazole-4-carboxamide.
| Compound Name | N-[(2S)-5-amino-1-oxo-1-[[(2R)-2-(2H-tetrazol-5-yl)cyclopentyl]amino]pentan-2-yl]-1-methylindazole-4-carboxamide |
|---|---|
| PubChem CID | 145488359 |
| Molecular Formula | C20H27N9O2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | N-[(2S)-5-amino-1-oxo-1-[[(2R)-2-(2H-tetrazol-5-yl)cyclopentyl]amino]pentan-2-yl]-1-methylindazole-4-carboxamide |
| SMILES | Cn1ncc2c(C(=O)N[C@@H](CCCN)C(=O)NC3CCC[C@H]3c3nn[nH]n3)cccc21 |
| InChI | InChI=1S/C20H27N9O2/c1-29-17-9-3-5-12(14(17)11-22-29)19(30)24-16(8-4-10-21)20(31)23-15-7-2-6-13(15)18-25-27-28-26-18/h3,5,9,11,13,15-16H,2,4,6-8,10,21H2,1H3,(H,23,31)(H,24,30)(H,25,26,27,28)/t13-,15?,16+/m1/s1 |
| InChIKey | BKEJQGKUXAFVDH-BXCKNWRKSA-N |
| XLogP | 0.38 |
| TPSA | 156.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |