About (4S)-4-amino-N-[(1S,2R)-2-(2H-tetrazol-5-yl)cyclopentyl]hexanamide
(4S)-4-amino-N-[(1S,2R)-2-(2H-tetrazol-5-yl)cyclopentyl]hexanamide (PubChem CID 59454005) has the molecular formula C12H22N6O
and a molecular weight of 266.35 g/mol. Its IUPAC name is (4S)-4-amino-N-[(1S,2R)-2-(2H-tetrazol-5-yl)cyclopentyl]hexanamide.
Molecular Properties
| Compound Name | (4S)-4-amino-N-[(1S,2R)-2-(2H-tetrazol-5-yl)cyclopentyl]hexanamide |
| PubChem CID | 59454005 |
| Molecular Formula | C12H22N6O |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (4S)-4-amino-N-[(1S,2R)-2-(2H-tetrazol-5-yl)cyclopentyl]hexanamide |
| SMILES | CC[C@H](N)CCC(=O)N[C@H]1CCC[C@H]1c1nn[nH]n1 |
| InChI | InChI=1S/C12H22N6O/c1-2-8(13)6-7-11(19)14-10-5-3-4-9(10)12-15-17-18-16-12/h8-10H,2-7,13H2,1H3,(H,14,19)(H,15,16,17,18)/t8-,9+,10-/m0/s1 |
| InChIKey | HDGBGFYJKJEDHM-AEJSXWLSSA-N |
| XLogP | 0.47 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4S)-4-amino-N-[(1S,2R)-2-(2H-tetrazol-5-yl)cyclopentyl]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-amino-N-[(1S,2R)-2-(2H-tetrazol-5-yl)cyclopentyl]hexanamide?
The IUPAC name of (4S)-4-amino-N-[(1S,2R)-2-(2H-tetrazol-5-yl)cyclopentyl]hexanamide (CID 59454005) is (4S)-4-amino-N-[(1S,2R)-2-(2H-tetrazol-5-yl)cyclopentyl]hexanamide.
What is the SMILES notation for (4S)-4-amino-N-[(1S,2R)-2-(2H-tetrazol-5-yl)cyclopentyl]hexanamide?
The canonical SMILES for (4S)-4-amino-N-[(1S,2R)-2-(2H-tetrazol-5-yl)cyclopentyl]hexanamide is CC[C@H](N)CCC(=O)N[C@H]1CCC[C@H]1c1nn[nH]n1.
What is the InChIKey of (4S)-4-amino-N-[(1S,2R)-2-(2H-tetrazol-5-yl)cyclopentyl]hexanamide?
The InChIKey is HDGBGFYJKJEDHM-AEJSXWLSSA-N. The full InChI is InChI=1S/C12H22N6O/c1-2-8(13)6-7-11(19)14-10-5-3-4-9(10)12-15-17-18-16-12/h8-10H,2-7,13H2,1H3,(H,14,19)(H,15,16,17,18)/t8-,9+,10-/m0/s1.
What are the key properties of (4S)-4-amino-N-[(1S,2R)-2-(2H-tetrazol-5-yl)cyclopentyl]hexanamide?
(4S)-4-amino-N-[(1S,2R)-2-(2H-tetrazol-5-yl)cyclopentyl]hexanamide has a molecular weight of 266.35 g/mol, XLogP of 0.47, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-amino-N-[(1S,2R)-2-(2H-tetrazol-5-yl)cyclopentyl]hexanamide is sourced from PubChem (CID 59454005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).